|
CAS#: 29939-31-9 Product: 2,4-Di-Tert-Butylpyridine No suppilers available for the product. |
| Name | 2,4-Di-Tert-Butylpyridine |
|---|---|
| Synonyms | Pyridine, 2,4-Bis(1,1-Dimethylethyl)-; Pyridine, 2,4-Di(T-Butyl)-; 2,4-Bis(T-Butyl)Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 |
| CAS Registry Number | 29939-31-9 |
| SMILES | C1=C(N=CC=C1C(C)(C)C)C(C)(C)C |
| InChI | 1S/C13H21N/c1-12(2,3)10-7-8-14-11(9-10)13(4,5)6/h7-9H,1-6H3 |
| InChIKey | LEOBMIVTCWKNCB-UHFFFAOYSA-N |
| Density | 0.886g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.747°C at 760 mmHg (Cal.) |
| Flash point | 86.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Di-Tert-Butylpyridine |