|
CAS#: 30544-58-2 Product: 4-[Acetyl-[3-(Trifluoromethyl)Phenyl]Amino]Butanoic Acid No suppilers available for the product. |
| Name | 4-[Acetyl-[3-(Trifluoromethyl)Phenyl]Amino]Butanoic Acid |
|---|---|
| Synonyms | 4-[Acetyl-[3-(Trifluoromethyl)Phenyl]Amino]Butyric Acid; 4-[Ethanoyl-[3-(Trifluoromethyl)Phenyl]Amino]Butanoic Acid; 4-(N-(Alpha,Alpha,Alpha-Trifluoro-M-Tolyl)Acetamido)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 |
| CAS Registry Number | 30544-58-2 |
| SMILES | C1=C(N(CCCC(O)=O)C(C)=O)C=CC=C1C(F)(F)F |
| InChI | 1S/C13H14F3NO3/c1-9(18)17(7-3-6-12(19)20)11-5-2-4-10(8-11)13(14,15)16/h2,4-5,8H,3,6-7H2,1H3,(H,19,20) |
| InChIKey | BHYIIPMHZNLRTN-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.172°C at 760 mmHg (Cal.) |
| Flash point | 204.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Acetyl-[3-(Trifluoromethyl)Phenyl]Amino]Butanoic Acid |