|
CAS#: 3067-12-7 Product: Benzo[b]Pyrene-6,12-Dione No suppilers available for the product. |
| Name | Benzo[b]Pyrene-6,12-Dione |
|---|---|
| Synonyms | Benzo[B]Pyrene-6,12-Quinone; Aids132177; Benzo[Def]Chrysene-6,12-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C20H10O2 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 3067-12-7 |
| SMILES | C1=C3C(=CC=C1)C(=O)C2=CC=C5C4=C2C3=CC(=O)C4=CC=C5 |
| InChI | 1S/C20H10O2/c21-17-10-16-12-5-1-2-6-13(12)20(22)15-9-8-11-4-3-7-14(17)18(11)19(15)16/h1-10H |
| InChIKey | HSJQJGAVYCLWJA-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.853°C at 760 mmHg (Cal.) |
| Flash point | 195.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[b]Pyrene-6,12-Dione |