|
CAS#: 30778-28-0 Product: 4-(3,3-Diphenylprop-2-Enyl)Morpholine Hydrochloride No suppilers available for the product. |
| Name | 4-(3,3-Diphenylprop-2-Enyl)Morpholine Hydrochloride |
|---|---|
| Synonyms | 4-(3,3-Diphenylallyl)Morpholine Hydrochloride; Morpholine, 4-(3,3-Diphenylallyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 |
| CAS Registry Number | 30778-28-0 |
| SMILES | [H+].C3=C(C(C1=CC=CC=C1)=CCN2CCOCC2)C=CC=C3.[Cl-] |
| InChI | 1S/C19H21NO.ClH/c1-3-7-17(8-4-1)19(18-9-5-2-6-10-18)11-12-20-13-15-21-16-14-20;/h1-11H,12-16H2;1H |
| InChIKey | RAOBMCMJXIQUKA-UHFFFAOYSA-N |
| Boiling point | 433.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 127°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3,3-Diphenylprop-2-Enyl)Morpholine Hydrochloride |