|
CAS#: 3114-52-1 Product: 2-(4-Chlorophenyl)-4,6-Di(Phenyl)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-4,6-Di(Phenyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-4,6-Di(Phenyl)-S-Triazine; 2-(P-Chlorophenyl)-4,6-Diphenyl-S-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H14ClN3 |
| Molecular Weight | 343.81 |
| CAS Registry Number | 3114-52-1 |
| SMILES | C1=CC(=CC=C1Cl)C2=NC(=NC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C21H14ClN3/c22-18-13-11-17(12-14-18)21-24-19(15-7-3-1-4-8-15)23-20(25-21)16-9-5-2-6-10-16/h1-14H |
| InChIKey | NTEIZPBYXABJKN-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.025°C at 760 mmHg (Cal.) |
| Flash point | 322.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-4,6-Di(Phenyl)-1,3,5-Triazine |