|
CAS#: 31428-94-1 Product: 4-[(E)-2-(3-Chlorophenyl)Vinyl]Pyridine No suppilers available for the product. |
| Name | 4-[(E)-2-(3-Chlorophenyl)Vinyl]Pyridine |
|---|---|
| Synonyms | 3'-Chloro-4-stilbazole |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 |
| CAS Registry Number | 31428-94-1 |
| SMILES | Clc2cccc(\C=C\c1ccncc1)c2 |
| InChI | 1S/C13H10ClN/c14-13-3-1-2-12(10-13)5-4-11-6-8-15-9-7-11/h1-10H/b5-4+ |
| InChIKey | HXOMWEIPKBRIHS-SNAWJCMRSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.395°C at 760 mmHg (Cal.) |
| Flash point | 194.754°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(E)-2-(3-Chlorophenyl)Vinyl]Pyridine |