|
CAS#: 31431-23-9 Product: (4-Amino-3-Nitrophenyl)(Cyclopropyl)Methanone No suppilers available for the product. |
| Name | (4-Amino-3-Nitrophenyl)(Cyclopropyl)Methanone |
|---|---|
| Synonyms | (4-amino-3-nitrophenyl) cyclopropyl ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 |
| CAS Registry Number | 31431-23-9 |
| EINECS | 250-632-8 |
| SMILES | O=C(c1cc(c(N)cc1)[N+]([O-])=O)C2CC2 |
| InChI | 1S/C10H10N2O3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2,11H2 |
| InChIKey | CWGGORUVLAOGPD-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.07°C at 760 mmHg (Cal.) |
| Flash point | 183.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Amino-3-Nitrophenyl)(Cyclopropyl)Methanone |