Online Database of Chemicals from Around the World
|
CAS#: 31651-04-4 Product: 2,8-Diamino-1,5-Dihydroxyanthracene-9,10-Dione No suppilers available for the product. |
| Name | 2,8-Diamino-1,5-Dihydroxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 2,8-Diamino-1,5-Dihydroxy-Anthracene-9,10-Dione; 2,8-Diamino-1,5-Dihydroxy-9,10-Anthraquinone; 2,8-Diamino-1,5-Dihydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 31651-04-4 |
| EINECS | 250-751-5 |
| SMILES | C1=CC(=C(O)C3=C1C(=O)C2=C(O)C=CC(=C2C3=O)N)N |
| InChI | 1S/C14H10N2O4/c15-6-3-4-8(17)11-10(6)14(20)9-5(12(11)18)1-2-7(16)13(9)19/h1-4,17,19H,15-16H2 |
| InChIKey | LKQHERLUEBGWGF-UHFFFAOYSA-N |
| Density | 1.684g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.206°C at 760 mmHg (Cal.) |
| Flash point | 327.075°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,8-Diamino-1,5-Dihydroxyanthracene-9,10-Dione |