|
CAS#: 3208-57-9 Product: (2-Aminonaphthalen-1-Yl) Dihydrogen Phosphate No suppilers available for the product. |
| Name | (2-Aminonaphthalen-1-Yl) Dihydrogen Phosphate |
|---|---|
| Synonyms | (2-Amino-1-Naphthyl) Dihydrogen Phosphate; 1-Naphthalenol, 2-Amino-, Hydrogen Phosphate (Ester); 1-Naphthol, 2-Amino-, Dihydrogen Phosphate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10NO4P |
| Molecular Weight | 239.17 |
| CAS Registry Number | 3208-57-9 |
| SMILES | C1=C(C(=C2C(=C1)C=CC=C2)O[P](=O)(O)O)N |
| InChI | 1S/C10H10NO4P/c11-9-6-5-7-3-1-2-4-8(7)10(9)15-16(12,13)14/h1-6H,11H2,(H2,12,13,14) |
| InChIKey | GLHOZUBGCUJSBE-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for (2-Aminonaphthalen-1-Yl) Dihydrogen Phosphate |