|
CAS#: 321-25-5 Product: 2-Fluoro-N,N-Dimethyl-4-Phenyldiazenylaniline No suppilers available for the product. |
| Name | 2-Fluoro-N,N-Dimethyl-4-Phenyldiazenylaniline |
|---|---|
| Synonyms | 2-Fluoro-N,N-Dimethyl-4-Phenylazo-Aniline; 2-Fluoro-N,N-Dimethyl-4-Phenylazoaniline; (2-Fluoro-4-Phenylazo-Phenyl)-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14FN3 |
| Molecular Weight | 243.28 |
| CAS Registry Number | 321-25-5 |
| SMILES | C1=C(C(=CC(=C1)N=NC2=CC=CC=C2)F)N(C)C |
| InChI | 1S/C14H14FN3/c1-18(2)14-9-8-12(10-13(14)15)17-16-11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | KIBZHRFPPOCTSY-UHFFFAOYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.011°C at 760 mmHg (Cal.) |
| Flash point | 178.786°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-N,N-Dimethyl-4-Phenyldiazenylaniline |