|
CAS#: 32150-39-3 Product: 3-Cyclopentyl-5-Dimethylamino-1,6-Dimethylpyrimidine-2,4-Dione No suppilers available for the product. |
| Name | 3-Cyclopentyl-5-Dimethylamino-1,6-Dimethylpyrimidine-2,4-Dione |
|---|---|
| Synonyms | 3-Cyclopentyl-5-Dimethylamino-1,6-Dimethyl-Pyrimidine-2,4-Dione; 3-Cyclopentyl-5-Dimethylamino-1,6-Dimethyl-Pyrimidine-2,4-Quinone; Uracil, 3-Cyclopentyl-1,6-Dimethyl-5-Dimethylamino- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 |
| CAS Registry Number | 32150-39-3 |
| SMILES | CN(C)C2=C(C)N(C)C(=O)N(C1CCCC1)C2=O |
| InChI | 1S/C13H21N3O2/c1-9-11(14(2)3)12(17)16(13(18)15(9)4)10-7-5-6-8-10/h10H,5-8H2,1-4H3 |
| InChIKey | KAHQJDOPZZKJHB-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.11°C at 760 mmHg (Cal.) |
| Flash point | 136.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclopentyl-5-Dimethylamino-1,6-Dimethylpyrimidine-2,4-Dione |