|
CAS#: 32280-72-1 Product: N-(4-Chloro-2-Methylphenyl)-1-[(E)-3-Chloroprop-2-Enyl]Pyrrolidin-2-Imine No suppilers available for the product. |
| Name | N-(4-Chloro-2-Methylphenyl)-1-[(E)-3-Chloroprop-2-Enyl]Pyrrolidin-2-Imine |
|---|---|
| Synonyms | N-(4-Chloro-2-Methyl-Phenyl)-1-[(E)-3-Chloroprop-2-Enyl]Pyrrolidin-2-Imine; N-(4-Chloro-2-Methylphenyl)-1-[(E)-3-Chloroprop-2-Enyl]-2-Pyrrolidinimine; (4-Chloro-2-Methyl-Phenyl)-[1-[(E)-3-Chloroprop-2-Enyl]Pyrrolidin-2-Ylidene]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 |
| CAS Registry Number | 32280-72-1 |
| SMILES | C1=C(C(=CC=C1Cl)N=C2N(CCC2)C\C=C\Cl)C |
| InChI | 1S/C14H16Cl2N2/c1-11-10-12(16)5-6-13(11)17-14-4-2-8-18(14)9-3-7-15/h3,5-7,10H,2,4,8-9H2,1H3/b7-3+,17-14? |
| InChIKey | JFCLLYIQQNUTEN-QTGLWHKESA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.317°C at 760 mmHg (Cal.) |
| Flash point | 201.348°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Chloro-2-Methylphenyl)-1-[(E)-3-Chloroprop-2-Enyl]Pyrrolidin-2-Imine |