|
CAS#: 32348-89-3 Product: Dipotassium Phenyl Phosphate No suppilers available for the product. |
| Name | Dipotassium Phenyl Phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H5K2O4P |
| Molecular Weight | 250.27 |
| CAS Registry Number | 32348-89-3 |
| EINECS | 251-000-4 |
| SMILES | C1=C(O[P](=O)([O-])[O-])C=CC=C1.[K+].[K+] |
| InChI | 1S/C6H7O4P.2K/c7-11(8,9)10-6-4-2-1-3-5-6;;/h1-5H,(H2,7,8,9);;/q;2*+1/p-2 |
| InChIKey | DVXOPOCXFDGNKS-UHFFFAOYSA-L |
| Boiling point | 346.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 163.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipotassium Phenyl Phosphate |