|
CAS#: 32386-87-1 Product: 2,3-Dihydro-1H-Benz(de)Isoquinoline Hydrochloride No suppilers available for the product. |
| Name | 2,3-Dihydro-1H-Benz(de)Isoquinoline Hydrochloride |
|---|---|
| Synonyms | 2,3-Dihydro-1H-Benz(De)Isoquinoline Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.69 |
| CAS Registry Number | 32386-87-1 |
| SMILES | [H+].C3=C1C2=C(CNC1)C=CC=C2C=C3.[Cl-] |
| InChI | 1S/C12H11N.ClH/c1-3-9-4-2-6-11-8-13-7-10(5-1)12(9)11;/h1-6,13H,7-8H2;1H |
| InChIKey | RHJYITSOKPRKHB-UHFFFAOYSA-N |
| Boiling point | 334.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 171.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-1H-Benz(de)Isoquinoline Hydrochloride |