Online Database of Chemicals from Around the World
|
CAS#: 32606-04-5 Product: 4-Methoxy-1,3-Dimethylquinolin-2-One No suppilers available for the product. |
| Name | 4-Methoxy-1,3-Dimethylquinolin-2-One |
|---|---|
| Synonyms | 4-Methoxy-1,3-Dimethyl-Quinolin-2-One; 4-Methoxy-1,3-Dimethyl-2-Quinolinone; 4-Methoxy-1,3-Dimethyl-Carbostyril |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 32606-04-5 |
| SMILES | C1=C2C(=CC=C1)N(C(=O)C(=C2OC)C)C |
| InChI | 1S/C12H13NO2/c1-8-11(15-3)9-6-4-5-7-10(9)13(2)12(8)14/h4-7H,1-3H3 |
| InChIKey | KGJOYNVCJDCRTA-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.742°C at 760 mmHg (Cal.) |
| Flash point | 143.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-1,3-Dimethylquinolin-2-One |