|
CAS#: 3321-65-1 Product: alpha-Kessyl Alcohol No suppilers available for the product. |
| Name | alpha-Kessyl Alcohol |
|---|---|
| Synonyms | Nsc258305 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 3321-65-1 |
| SMILES | CC12C3C(CC(CC1)C(O2)(C)C)C(C)CC3O |
| InChI | 1S/C15H26O2/c1-9-7-12(16)13-11(9)8-10-5-6-15(13,4)17-14(10,2)3/h9-13,16H,5-8H2,1-4H3 |
| InChIKey | ZADVMZUKWWMSLQ-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.887°C at 760 mmHg (Cal.) |
| Flash point | 122.784°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Kessyl Alcohol |