|
CAS#: 3321-86-6 Product: 10-[2-(10-Oxoanthracen-9-Ylidene)Ethenylidene]Anthracen-9-One No suppilers available for the product. |
| Name | 10-[2-(10-Oxoanthracen-9-Ylidene)Ethenylidene]Anthracen-9-One |
|---|---|
| Synonyms | 10-[2-(10-Oxo-9-Anthrylidene)Ethenylidene]Anthracen-9-One; 10-[2-(10-Oxo-9-Anthrylidene)Ethenylidene]-9-Anthracenone; 10-[2-(10-Keto-9-Anthrylidene)Ethenylidene]Anthracen-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C30H16O2 |
| Molecular Weight | 408.46 |
| CAS Registry Number | 3321-86-6 |
| EINECS | 222-034-7 |
| SMILES | C(=C2C1=C(C=CC=C1)C(=O)C3=C2C=CC=C3)=C=C5C4=C(C=CC=C4)C(=O)C6=C5C=CC=C6 |
| InChI | 1S/C30H16O2/c31-29-25-13-5-1-9-19(25)23(20-10-2-6-14-26(20)29)17-18-24-21-11-3-7-15-27(21)30(32)28-16-8-4-12-22(24)28/h1-16H |
| InChIKey | DATXULQQDBTIRC-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 693.181°C at 760 mmHg (Cal.) |
| Flash point | 246.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-[2-(10-Oxoanthracen-9-Ylidene)Ethenylidene]Anthracen-9-One |