|
CAS#: 33342-89-1 Product: 1-{4-[(Trimethylsilyl)Oxy]Phenyl}-1-Propanone No suppilers available for the product. |
| Name | 1-{4-[(Trimethylsilyl)Oxy]Phenyl}-1-Propanone |
|---|---|
| Synonyms | 1-(4-[(Trimethylsilyl)oxy]phenyl)-1-propanone #; Trimethylsilyl ether of p-hydroxypropiophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2Si |
| Molecular Weight | 222.36 |
| CAS Registry Number | 33342-89-1 |
| SMILES | O=C(c1ccc(O[Si](C)(C)C)cc1)CC |
| InChI | 1S/C12H18O2Si/c1-5-12(13)10-6-8-11(9-7-10)14-15(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | LKRFHGYECXRRCO-UHFFFAOYSA-N |
| Density | 0.966g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.19°C at 760 mmHg (Cal.) |
| Flash point | 96.967°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{4-[(Trimethylsilyl)Oxy]Phenyl}-1-Propanone |