CAS#: 3351-96-0 Product: Sporidesmin B No suppilers available for the product. |
Name | Sporidesmin B |
---|---|
Synonyms | 3,11A-Epidithio-11Ah-Pyrazino(1',2':1,5)Pyrrolo(2,3-B)Indole-1,4-Dione, 9-Chloro-2,3,5A,6,10B,11-Hexahydro-10B-Hydroxy-7,8-Dimethoxy-2,3,6-Trimethyl-; Nsc 246153; Nsc246153 |
Molecular Structure | ![]() |
Molecular Formula | C18H20ClN3O5S2 |
Molecular Weight | 457.95 |
CAS Registry Number | 3351-96-0 |
SMILES | C1=C4C(=C(OC)C(=C1Cl)OC)N(C5N3C2(C(N(C)C(SS2)(C)C3=O)=O)CC45O)C |
InChI | 1S/C18H20ClN3O5S2/c1-16-14(23)22-13-17(25,7-18(22,29-28-16)15(24)21(16)3)8-6-9(19)11(26-4)12(27-5)10(8)20(13)2/h6,13,25H,7H2,1-5H3 |
InChIKey | HCAHETRFJITQNU-UHFFFAOYSA-N |
Density | 1.676g/cm3 (Cal.) |
---|---|
Boiling point | 740.41°C at 760 mmHg (Cal.) |
Flash point | 401.585°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Sporidesmin B |