|
CAS#: 33781-24-7 Product: (2-Chlorophenyl)Arsonic Acid No suppilers available for the product. |
| Name | (2-Chlorophenyl)Arsonic Acid |
|---|---|
| Synonyms | O-Chlorobenzenearsonic Acid; O-Chlorophenylarsonic Acid; Arsonic Acid, (2-Chlorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6AsClO3 |
| Molecular Weight | 236.49 |
| CAS Registry Number | 33781-24-7 |
| SMILES | C1=CC=CC(=C1[As](O)(O)=O)Cl |
| InChI | 1S/C6H6AsClO3/c8-6-4-2-1-3-5(6)7(9,10)11/h1-4H,(H2,9,10,11) |
| InChIKey | GUGCAIIPJMERPL-UHFFFAOYSA-N |
| Boiling point | 469.432°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 237.704°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chlorophenyl)Arsonic Acid |