| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 1-(Phenoxy)Naphthalene |
|---|---|
| Synonyms | Nsc37150; 1-Naphthyl Phenyl Ether; Naphthalene, 1-Phenoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 |
| CAS Registry Number | 3402-76-4 |
| SMILES | C3=CC=C(OC1=CC=CC2=C1C=CC=C2)C=C3 |
| InChI | 1S/C16H12O/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16/h1-12H |
| InChIKey | DABOOAVTBIRGHP-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.498°C at 760 mmHg (Cal.) |
| Flash point | 166.838°C (Cal.) |
| (1) | Kokkirala Swapna, Sabbavarapu Narayana Murthy, Mocharla Tarani Jyothi and Yadavalli Venkata Durga Nageswar. Recyclable heterogeneous copper oxide on alumina catalyzed coupling of phenols and alcohols with aryl halides under ligand-free conditions, Org. Biomol. Chem., 2011, 9, 5978. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(Phenoxy)Naphthalene |