Online Database of Chemicals from Around the World
|
CAS#: 3414-69-5 Product: 5-Nitro-3-(Piperidin-1-Ylmethyl)-1H-Indole No suppilers available for the product. |
| Name | 5-Nitro-3-(Piperidin-1-Ylmethyl)-1H-Indole |
|---|---|
| Synonyms | 5-Nitro-3-(1-Piperidylmethyl)-1H-Indole; 5-Nitro-3-(Piperidinomethyl)-1H-Indole; 5-Nitro-3-(Piperidinomethyl)Indole |
| Molecular Structure |  |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 |
| CAS Registry Number | 3414-69-5 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1C(=C[NH]2)CN3CCCCC3 |
| InChI | 1S/C14H17N3O2/c18-17(19)12-4-5-14-13(8-12)11(9-15-14)10-16-6-2-1-3-7-16/h4-5,8-9,15H,1-3,6-7,10H2 |
| InChIKey | OUZMDCXVRKYIHS-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.054°C at 760 mmHg (Cal.) |
| Flash point | 221.146°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-3-(Piperidin-1-Ylmethyl)-1H-Indole |