Online Database of Chemicals from Around the World
|
CAS#: 34346-99-1 Product: 7-(Bromomethyl)-4-Chlorobenzo[a]Anthracene No suppilers available for the product. |
| Name | 7-(Bromomethyl)-4-Chlorobenzo[a]Anthracene |
|---|---|
| Synonyms | 7-(Bromomethyl)-4-Chloro-Benzo[A]Anthracene; 4-Chloro-7-Bromomethylbenz(A)Anthracene; 7-Bromomethyl-4-Chlorobenz(A)Anthracene |
| Molecular Structure | ![CAS#: 34346-99-1, 7-(Bromomethyl)-4-Chlorobenzo[a]Anthracene](/moreStructures/34346-99-1.gif) |
| Molecular Formula | C19H12BrCl |
| Molecular Weight | 355.66 |
| CAS Registry Number | 34346-99-1 |
| SMILES | C1=C3C(=C(C2=CC=CC=C12)CBr)C=CC4=C3C=CC=C4Cl |
| InChI | 1S/C19H12BrCl/c20-11-18-13-5-2-1-4-12(13)10-17-14-6-3-7-19(21)16(14)9-8-15(17)18/h1-10H,11H2 |
| InChIKey | DYAOQUBNQRBREA-UHFFFAOYSA-N |
| Density | 1.525g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.952°C at 760 mmHg (Cal.) |
| Flash point | 282.455°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(Bromomethyl)-4-Chlorobenzo[a]Anthracene |