|
CAS#: 34472-48-5 Product: 1-Propan-2-Ylideneindene No suppilers available for the product. |
| Name | 1-Propan-2-Ylideneindene |
|---|---|
| Synonyms | 1-Isopropylideneindene; 1H-Indene, 1-(1-Methylethylidene)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 |
| CAS Registry Number | 34472-48-5 |
| EINECS | 252-054-1 |
| SMILES | C1=CC=CC2=C1C(C=C2)=C(C)C |
| InChI | 1S/C12H12/c1-9(2)11-8-7-10-5-3-4-6-12(10)11/h3-8H,1-2H3 |
| InChIKey | UFTDYDBGSOOBGX-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.446°C at 760 mmHg (Cal.) |
| Flash point | 99.565°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Propan-2-Ylideneindene |