|
CAS#: 34594-47-3 Product: 1,3-Dimethyl-1,3-Bis(4-Nitrophenyl)Urea No suppilers available for the product. |
| Name | 1,3-Dimethyl-1,3-Bis(4-Nitrophenyl)Urea |
|---|---|
| Synonyms | 4,4'-Dinitro-N,N'-Dimethylcarbanilide; 4-12-00-01652 (Beilstein Handbook Reference); Ai3-27441 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N4O5 |
| Molecular Weight | 330.30 |
| CAS Registry Number | 34594-47-3 |
| SMILES | C2=C(N(C(=O)N(C1=CC=C([N+]([O-])=O)C=C1)C)C)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C15H14N4O5/c1-16(11-3-7-13(8-4-11)18(21)22)15(20)17(2)12-5-9-14(10-6-12)19(23)24/h3-10H,1-2H3 |
| InChIKey | FDJGIYFXRLDEJB-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.365°C at 760 mmHg (Cal.) |
| Flash point | 264.274°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-1,3-Bis(4-Nitrophenyl)Urea |