|
CAS#: 34619-07-3 Product: 1-[Bis(Dimethylamino)Methylidene]-3,3-Dimethylthiourea No suppilers available for the product. |
| Name | 1-[Bis(Dimethylamino)Methylidene]-3,3-Dimethylthiourea |
|---|---|
| Synonyms | 1-[Bis(Dimethylamino)Methylene]-3,3-Dimethyl-Thiourea; 1-[Bis(Dimethylamino)Methylene]-3,3-Dimethylthiourea; 1-[Bis(Dimethylamino)Methylidene]-3,3-Dimethyl-Thiourea |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18N4S |
| Molecular Weight | 202.32 |
| CAS Registry Number | 34619-07-3 |
| EINECS | 252-114-7 |
| SMILES | CN(C(=NC(=S)N(C)C)N(C)C)C |
| InChI | 1S/C8H18N4S/c1-10(2)7(11(3)4)9-8(13)12(5)6/h1-6H3 |
| InChIKey | GGNRRWRAKZQSKG-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.847°C at 760 mmHg (Cal.) |
| Flash point | 102.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[Bis(Dimethylamino)Methylidene]-3,3-Dimethylthiourea |