|
CAS#: 34619-37-9 Product: 5-Butyl-3,3-Dichlorooxolan-2-One No suppilers available for the product. |
| Name | 5-Butyl-3,3-Dichlorooxolan-2-One |
|---|---|
| Synonyms | 5-Butyl-3,3-Dichloro-Tetrahydrofuran-2-One; 5-Butyl-3,3-Dichloro-2-Tetrahydrofuranone; 5-Butyl-3,3-Dichloro-Oxolan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12Cl2O2 |
| Molecular Weight | 211.09 |
| CAS Registry Number | 34619-37-9 |
| EINECS | 252-116-8 |
| SMILES | C(C1OC(=O)C(Cl)(Cl)C1)CCC |
| InChI | 1S/C8H12Cl2O2/c1-2-3-4-6-5-8(9,10)7(11)12-6/h6H,2-5H2,1H3 |
| InChIKey | JAPULIJSISIKSZ-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.45°C at 760 mmHg (Cal.) |
| Flash point | 130.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Butyl-3,3-Dichlorooxolan-2-One |