|
CAS#: 3463-93-2 Product: (4E,5R)-4-Ethylidene-1,3,4,5,6,7-Hexahydro-6-Methylene-2,5-Ethano-2H-Azocino[4,3-b]Indole No suppilers available for the product. |
| Name | (4E,5R)-4-Ethylidene-1,3,4,5,6,7-Hexahydro-6-Methylene-2,5-Ethano-2H-Azocino[4,3-b]Indole |
|---|---|
| Synonyms | Aids-058061; Aids058061; Apparicine, Gomezine, Pericalline, Tabernoschizine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 |
| CAS Registry Number | 3463-93-2 |
| SMILES | [C@H]\23C(C1=CC4=C(C=C1CN(CC2=C/C)CC3)C=C[NH]4)=C |
| InChI | 1S/C18H20N2/c1-3-13-10-20-7-5-16(13)12(2)17-9-18-14(4-6-19-18)8-15(17)11-20/h3-4,6,8-9,16,19H,2,5,7,10-11H2,1H3/b13-3-/t16-/m0/s1 |
| InChIKey | YBWKMVPRGFJPHD-LELDJUSMSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.622°C at 760 mmHg (Cal.) |
| Flash point | 220.28°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4E,5R)-4-Ethylidene-1,3,4,5,6,7-Hexahydro-6-Methylene-2,5-Ethano-2H-Azocino[4,3-b]Indole |