|
CAS#: 34682-15-0 Product: (E)-4-[4-(2-Fluorophenyl)Phenyl]-4-Hydroxybut-2-Enoic Acid No suppilers available for the product. |
| Name | (E)-4-[4-(2-Fluorophenyl)Phenyl]-4-Hydroxybut-2-Enoic Acid |
|---|---|
| Synonyms | (E)-4-[4-(2-Fluorophenyl)Phenyl]-4-Hydroxy-But-2-Enoic Acid; Gq3550000; Sh 766 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13FO3 |
| Molecular Weight | 272.28 |
| CAS Registry Number | 34682-15-0 |
| SMILES | C1=CC(=CC=C1C(O)\C=C\C(O)=O)C2=C(C=CC=C2)F |
| InChI | 1S/C16H13FO3/c17-14-4-2-1-3-13(14)11-5-7-12(8-6-11)15(18)9-10-16(19)20/h1-10,15,18H,(H,19,20)/b10-9+ |
| InChIKey | IIIKDGJYYBWVJZ-MDZDMXLPSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.058°C at 760 mmHg (Cal.) |
| Flash point | 262.274°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-4-[4-(2-Fluorophenyl)Phenyl]-4-Hydroxybut-2-Enoic Acid |