|
CAS#: 35046-71-0 Product: 3,3,4,4-Tetraethyloxolane-2,5-Dione No suppilers available for the product. |
| Name | 3,3,4,4-Tetraethyloxolane-2,5-Dione |
|---|---|
| Synonyms | 3,3,4,4-Tetraethyltetrahydrofuran-2,5-Dione; 3,3,4,4-Tetraethyltetrahydrofuran-2,5-Quinone; Nci60_005193 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 35046-71-0 |
| SMILES | C(C1(C(C(OC1=O)=O)(CC)CC)CC)C |
| InChI | 1S/C12H20O3/c1-5-11(6-2)9(13)15-10(14)12(11,7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | APJHATHBVZSBMD-UHFFFAOYSA-N |
| Density | 0.965g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.97°C at 760 mmHg (Cal.) |
| Flash point | 126.742°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,4-Tetraethyloxolane-2,5-Dione |