| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 3-Nitrobenzoyl Azide |
|---|---|
| Synonyms | Azido-(3-Nitrophenyl)Methanone; M-Nitrobenzazide; Nsc17571 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4N4O3 |
| Molecular Weight | 192.13 |
| CAS Registry Number | 3532-31-8 |
| SMILES | N(=[N+]=[N-])C(=O)C1=CC=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C7H4N4O3/c8-10-9-7(12)5-2-1-3-6(4-5)11(13)14/h1-4H |
| InChIKey | MBUKWVQKGHOBTG-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrobenzoyl Azide |