|
CAS#: 35873-41-7 Product: 1,3-Dimethyl-8-Pentyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 1,3-Dimethyl-8-Pentyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-Amyl-1,3-Dimethyl-7H-Purine-2,6-Quinone; 3,7-Dihydro-1,3-Dimethyl-8-Pentyl-1H-Purine-2,6-Dione; 8-Pentyltheophylline |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 |
| CAS Registry Number | 35873-41-7 |
| SMILES | C(C2=NC1=C(C(N(C(N1C)=O)C)=O)[NH]2)CCCC |
| InChI | 1S/C12H18N4O2/c1-4-5-6-7-8-13-9-10(14-8)15(2)12(18)16(3)11(9)17/h4-7H2,1-3H3,(H,13,14) |
| InChIKey | KRQCFJVRGKISQO-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.826°C at 760 mmHg (Cal.) |
| Flash point | 240.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-8-Pentyl-7H-Purine-2,6-Dione |