|
CAS#: 35974-86-8 Product: [(E)-But-2-Enyl] Phosphate No suppilers available for the product. |
| Name | [(E)-But-2-Enyl] Phosphate |
|---|---|
| Synonyms | 2-Buten-1-Ol, Dihydrogen Phosphate, (E)-; Crotyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H7O4P |
| Molecular Weight | 150.07 |
| CAS Registry Number | 35974-86-8 |
| SMILES | C(O[P]([O-])([O-])=O)\C=C\C |
| InChI | 1S/C4H9O4P/c1-2-3-4-8-9(5,6)7/h2-3H,4H2,1H3,(H2,5,6,7)/p-2/b3-2+ |
| InChIKey | KCUTZTDKOSEILP-NSCUHMNNSA-L |
| Boiling point | 277.68°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121.737°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(E)-But-2-Enyl] Phosphate |