|
CAS#: 36540-51-9 Product: 4-[Di(Phenyl)Methyl]Thiophene-3-Carboxylic Acid No suppilers available for the product. |
| Name | 4-[Di(Phenyl)Methyl]Thiophene-3-Carboxylic Acid |
|---|---|
| Synonyms | 4-[Di(Phenyl)Methyl]-3-Thiophenecarboxylic Acid; 4-[Di(Phenyl)Methyl]-3-Thenoic Acid; Nsc241232 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O2S |
| Molecular Weight | 294.37 |
| CAS Registry Number | 36540-51-9 |
| SMILES | C1=CC(=CC=C1)C(C2=CSC=C2C(=O)O)C3=CC=CC=C3 |
| InChI | 1S/C18H14O2S/c19-18(20)16-12-21-11-15(16)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,17H,(H,19,20) |
| InChIKey | BYRUKMRBPYPFJR-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.956°C at 760 mmHg (Cal.) |
| Flash point | 233.183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Di(Phenyl)Methyl]Thiophene-3-Carboxylic Acid |