|
CAS#: 3691-12-1 Product: 1,4-Dimethyl-7-Prop-1-En-2-Yl-1,2,3,4,5,6,7,8-Octahydroazulene No suppilers available for the product. |
| Name | 1,4-Dimethyl-7-Prop-1-En-2-Yl-1,2,3,4,5,6,7,8-Octahydroazulene |
|---|---|
| Synonyms | 7-Isopropenyl-1,4-Dimethyl-1,2,3,4,5,6,7,8-Octahydroazulene; Azulene, 1,2,3,4,5,6,7,8-Octahydro-1,4-Dimethyl-7-(1-Methylethenyl)-, (1S,4S,7R)-; Azulene, 1,2,3,4,5,6,7,8-Octahydro-1,4-Dimethyl-7-(1-Methylethenyl)-, [1S-(1.Alpha.,4.Alpha.,7.Alpha.)]- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 3691-12-1 |
| SMILES | CC2C1=C(C(CCC(C1)C(=C)C)C)CC2 |
| InChI | 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-13H,1,5-9H2,2-4H3 |
| InChIKey | ADIDQIZBYUABQK-UHFFFAOYSA-N |
| Density | 0.894g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.066°C at 760 mmHg (Cal.) |
| Flash point | 111.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dimethyl-7-Prop-1-En-2-Yl-1,2,3,4,5,6,7,8-Octahydroazulene |