|
CAS#: 37031-93-9 Product: 2-Ethyl-2-thiopseudourea O-ethyl-(chloromethyl)phosphite No suppilers available for the product. |
| Name | 2-Ethyl-2-thiopseudourea O-ethyl-(chloromethyl)phosphite |
|---|---|
| Synonyms | Chloromethyl-Ethoxy-Phosphinic Acid; Ethylsulfanylformamidine; Chloromethyl-Ethoxyphosphinic Acid; (Ethylthio)Formamidine; Chloromethyl-Ethoxy-Phosphinic Acid; (Ethylthio)Formamidine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16ClN2O3PS |
| Molecular Weight | 262.69 |
| CAS Registry Number | 37031-93-9 |
| SMILES | C(Cl)[P](OCC)(=O)O.C(SC(=N)N)C |
| InChI | 1S/C3H8ClO3P.C3H8N2S/c1-2-7-8(5,6)3-4;1-2-6-3(4)5/h2-3H2,1H3,(H,5,6);2H2,1H3,(H3,4,5) |
| InChIKey | YRUMRASALXLUOM-UHFFFAOYSA-N |
| Boiling point | 225.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 90.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-2-thiopseudourea O-ethyl-(chloromethyl)phosphite |