|
CAS#: 37567-58-1 Product: 4-(2-Nitroethyl)Phenol No suppilers available for the product. |
| Name | 4-(2-Nitroethyl)Phenol |
|---|---|
| Synonyms | 1-Aci-Nitro-2-(P-Hydroxyphenyl)Ethane; 1-Nitro-2-(4-Hydroxyphenyl)Ethane; Phenol, 4-(2-Nitroethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 |
| CAS Registry Number | 37567-58-1 |
| SMILES | C1=CC(=CC=C1O)CC[N+]([O-])=O |
| InChI | 1S/C8H9NO3/c10-8-3-1-7(2-4-8)5-6-9(11)12/h1-4,10H,5-6H2 |
| InChIKey | VUBNQBXWQVHBLU-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.14°C at 760 mmHg (Cal.) |
| Flash point | 154.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Nitroethyl)Phenol |