|
CAS#: 37661-32-8 Product: Potassium 2-(2-Aminophenyl)Acetate No suppilers available for the product. |
| Name | Potassium 2-(2-Aminophenyl)Acetate |
|---|---|
| Synonyms | Potassium 2-(2-Aminophenyl)Ethanoate; Monopotassium (R)-Aminophenylacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8KNO2 |
| Molecular Weight | 189.25 |
| CAS Registry Number | 37661-32-8 |
| EINECS | 253-582-5 |
| SMILES | C1=CC=CC(=C1CC([O-])=O)N.[K+] |
| InChI | 1S/C8H9NO2.K/c9-7-4-2-1-3-6(7)5-8(10)11;/h1-4H,5,9H2,(H,10,11);/q;+1/p-1 |
| InChIKey | NJZCNQUYHKCBOP-UHFFFAOYSA-M |
| Boiling point | 344.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 162.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 2-(2-Aminophenyl)Acetate |