|
CAS#: 38314-91-9 Product: 1-Methyl-6-Nitro-9H-Pyrido[3,4-b]Indole No suppilers available for the product. |
| Name | 1-Methyl-6-Nitro-9H-Pyrido[3,4-b]Indole |
|---|---|
| Synonyms | 1-Methyl-6-Nitro-9H-$B-Carboline; Brn 0225341; Nsc 527515 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 |
| CAS Registry Number | 38314-91-9 |
| SMILES | C1=C([N+]([O-])=O)C=CC3=C1C2=C(C(=NC=C2)C)[NH]3 |
| InChI | 1S/C12H9N3O2/c1-7-12-9(4-5-13-7)10-6-8(15(16)17)2-3-11(10)14-12/h2-6,14H,1H3 |
| InChIKey | KHTDXKAUSUJSQZ-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.678°C at 760 mmHg (Cal.) |
| Flash point | 242.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-6-Nitro-9H-Pyrido[3,4-b]Indole |