|
CAS#: 38322-77-9 Product: Ethyl 4-Sulfanylidenechromene-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl 4-Sulfanylidenechromene-2-Carboxylate |
|---|---|
| Synonyms | Ethyl 4-Thioxochromene-2-Carboxylate; 4-Thioxo-2-Chromenecarboxylic Acid Ethyl Ester; 4-Thioxochromene-2-Carboxylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.27 |
| CAS Registry Number | 38322-77-9 |
| SMILES | C1=C2C(=CC=C1)C(C=C(O2)C(=O)OCC)=S |
| InChI | 1S/C12H10O3S/c1-2-14-12(13)10-7-11(16)8-5-3-4-6-9(8)15-10/h3-7H,2H2,1H3 |
| InChIKey | DXWBCHFGULQNLY-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.436°C at 760 mmHg (Cal.) |
| Flash point | 152.433°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-Sulfanylidenechromene-2-Carboxylate |