|
CAS#: 38818-49-4 Product: 5-Methyl-2-Nitrobenzoyl Chloride No suppilers available for the product. |
| Name | 5-Methyl-2-Nitrobenzoyl Chloride |
|---|---|
| Synonyms | 5-Methyl-2-Nitro-Benzoyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59 |
| CAS Registry Number | 38818-49-4 |
| EINECS | 254-132-0 |
| SMILES | C1=C(C=CC(=C1C(Cl)=O)[N+]([O-])=O)C |
| InChI | 1S/C8H6ClNO3/c1-5-2-3-7(10(12)13)6(4-5)8(9)11/h2-4H,1H3 |
| InChIKey | WAYVZRALCRKXTF-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.605°C at 760 mmHg (Cal.) |
| Flash point | 154.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-Nitrobenzoyl Chloride |