|
CAS#: 39206-13-8 Product: 2-Chloro-6-Cyclohexyl-4-Nitrophenol No suppilers available for the product. |
| Name | 2-Chloro-6-Cyclohexyl-4-Nitrophenol |
|---|---|
| Synonyms | 2-Chloro-6-Cyclohexyl-4-Nitro-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 |
| CAS Registry Number | 39206-13-8 |
| EINECS | 254-355-3 |
| SMILES | C2=C([N+]([O-])=O)C=C(C1CCCCC1)C(=C2Cl)O |
| InChI | 1S/C12H14ClNO3/c13-11-7-9(14(16)17)6-10(12(11)15)8-4-2-1-3-5-8/h6-8,15H,1-5H2 |
| InChIKey | HOVSIVIXNWEURQ-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.915°C at 760 mmHg (Cal.) |
| Flash point | 143.651°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-Cyclohexyl-4-Nitrophenol |