|
CAS#: 39401-05-3 Product: iso-Butyl methacrylate, vinyltoluene polymer No suppilers available for the product. |
| Name | iso-Butyl methacrylate, vinyltoluene polymer |
|---|---|
| Synonyms | Isobutyl 2-Methylprop-2-Enoate; 1-Methyl-2-Vinyl-Benzene; 2-Methylprop-2-Enoic Acid Isobutyl Ester; 1-Methyl-2-Vinylbenzene; 2-Methylacrylic Acid Isobutyl Ester; 1-Methyl-2-Vinyl-Benzene |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 |
| CAS Registry Number | 39401-05-3 |
| SMILES | C(OC(=O)C(=C)C)C(C)C.C1=C(C(=CC=C1)C)C=C |
| InChI | 1S/C9H10.C8H14O2/c1-3-9-7-5-4-6-8(9)2;1-6(2)5-10-8(9)7(3)4/h3-7H,1H2,2H3;6H,3,5H2,1-2,4H3 |
| InChIKey | AYIJLMMQOJAFRQ-UHFFFAOYSA-N |
| Boiling point | 155°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 44.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for iso-Butyl methacrylate, vinyltoluene polymer |