|
CAS#: 3941-06-8 Product: Methyl-[2-(Phenoxy)Ethylamino]Azanium (Z)-4-Hydroxy-4-Oxobut-2-Enoate No suppilers available for the product. |
| Name | Methyl-[2-(Phenoxy)Ethylamino]Azanium (Z)-4-Hydroxy-4-Oxobut-2-Enoate |
|---|---|
| Synonyms | (Z)-4-Hydroxy-4-Oxo-But-2-Enoate; Methyl-[2-(Phenoxy)Ethylamino]Ammonium; (Z)-4-Hydroxy-4-Oxobut-2-Enoate; Methyl-[2-(Phenoxy)Ethylamino]Ammonium; (Z)-4-Hydroxy-4-Keto-But-2-Enoate; Methyl-[2-(Phenoxy)Ethylamino]Ammonium |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 3941-06-8 |
| SMILES | C1=C(OCCN[NH2+]C)C=CC=C1.O=C([O-])\C=C/C(=O)O |
| InChI | 1S/C9H14N2O.C4H4O4/c1-10-11-7-8-12-9-5-3-2-4-6-9;5-3(6)1-2-4(7)8/h2-6,10-11H,7-8H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VZRCOKCPNUQIBW-BTJKTKAUSA-N |
| Boiling point | 257.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl-[2-(Phenoxy)Ethylamino]Azanium (Z)-4-Hydroxy-4-Oxobut-2-Enoate |