|
CAS#: 39479-71-5 Product: Diethyl 4,7-Dioxo-1,10-Dihydro-1,10-Phenanthroline-3,8-Dicarboxylate No suppilers available for the product. |
| Name | Diethyl 4,7-Dioxo-1,10-Dihydro-1,10-Phenanthroline-3,8-Dicarboxylate |
|---|---|
| Synonyms | 4,7-Dioxo-1,10-Dihydro-1,10-Phenanthroline-3,8-Dicarboxylic Acid Diethyl Ester; 4,7-Diketo-1,10-Dihydro-1,10-Phenanthroline-3,8-Dicarboxylic Acid Diethyl Ester; 1,10-Phenanthroline-3,8-Dicarboxylic Acid, 4,7-Dihydroxy-, Diethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 |
| CAS Registry Number | 39479-71-5 |
| EINECS | 254-468-8 |
| SMILES | C2=CC1=C(NC=C(C1=O)C(OCC)=O)C3=C2C(=O)C(=CN3)C(OCC)=O |
| InChI | 1S/C18H16N2O6/c1-3-25-17(23)11-7-19-13-9(15(11)21)5-6-10-14(13)20-8-12(16(10)22)18(24)26-4-2/h5-8H,3-4H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | PMZGJTQGPUEOKK-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.537°C at 760 mmHg (Cal.) |
| Flash point | 275.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 4,7-Dioxo-1,10-Dihydro-1,10-Phenanthroline-3,8-Dicarboxylate |