|
CAS#: 39557-39-6 Product: Di-Thio-Bis(N-Phenylmaleimide) No suppilers available for the product. |
| Name | Di-Thio-Bis(N-Phenylmaleimide) |
|---|---|
| Synonyms | 1-[4-[4-(2,5-Dioxo-1-Pyrrolyl)Phenyl]Disulfanylphenyl]Pyrrole-2,5-Dione; 1-[4-(4-Maleimidophenyl)Disulfanylphenyl]-3-Pyrroline-2,5-Quinone; 1,1-(Dithiodi-4,1-Phenylene)Bis-1H-Pyrrole-2,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12N2O4S2 |
| Molecular Weight | 408.45 |
| CAS Registry Number | 39557-39-6 |
| SMILES | C1=CC(=CC=C1N2C(C=CC2=O)=O)SSC3=CC=C(C=C3)N4C(C=CC4=O)=O |
| InChI | 1S/C20H12N2O4S2/c23-17-9-10-18(24)21(17)13-1-5-15(6-2-13)27-28-16-7-3-14(4-8-16)22-19(25)11-12-20(22)26/h1-12H |
| InChIKey | MPLHZTWRCINWPX-UHFFFAOYSA-N |
| Density | 1.587g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.836°C at 760 mmHg (Cal.) |
| Flash point | 328.665°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di-Thio-Bis(N-Phenylmaleimide) |