|
CAS#: 3989-90-0 Product: 2-Nitrochrysene No suppilers available for the product. |
| Name | 2-Nitrochrysene |
|---|---|
| Synonyms | Brn 5438027; Ccris 4949; Chrysene, 2-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.29 |
| CAS Registry Number | 3989-90-0 |
| SMILES | C4=CC2=C(C=CC3=C1C=CC=CC1=CC=C23)C=C4[N+]([O-])=O |
| InChI | 1S/C18H11NO2/c20-19(21)14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17/h1-11H |
| InChIKey | HYNWUPUJMIJKMW-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.848°C at 760 mmHg (Cal.) |
| Flash point | 258.76°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitrochrysene |