|
CAS#: 40041-95-0 Product: Angustoline No suppilers available for the product. |
| Name | Angustoline |
|---|---|
| Synonyms | Indolo(2',3':3,4)Pyrido(1,2-B)(2,7)Naphthyridin-5(7H)-One, 8,13-Dihydro-1-(1-Hydroxyethyl)-, (-)-; Acon1_001552 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.37 |
| CAS Registry Number | 40041-95-0 |
| SMILES | C1=NC=C(C2=C1C(N5C(=C2)C4=C(C3=CC=CC=C3[NH]4)CC5)=O)C(O)C |
| InChI | 1S/C20H17N3O2/c1-11(24)15-9-21-10-16-14(15)8-18-19-13(6-7-23(18)20(16)25)12-4-2-3-5-17(12)22-19/h2-5,8-11,22,24H,6-7H2,1H3 |
| InChIKey | NDHJXXLIRWAMEN-UHFFFAOYSA-N |
| Density | 1.464g/cm3 (Cal.) |
|---|---|
| Boiling point | 698.814°C at 760 mmHg (Cal.) |
| Flash point | 376.429°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Angustoline |