|
CAS#: 40217-50-3 Product: Angustidine No suppilers available for the product. |
| Name | Angustidine |
|---|---|
| Synonyms | Angustidine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 |
| CAS Registry Number | 40217-50-3 |
| SMILES | C1=C5C(=CC(=N1)C)C=C4C2=C(C3=C([NH]2)C=CC=C3)CCN4C5=O |
| InChI | 1S/C19H15N3O/c1-11-8-12-9-17-18-14(13-4-2-3-5-16(13)21-18)6-7-22(17)19(23)15(12)10-20-11/h2-5,8-10,21H,6-7H2,1H3 |
| InChIKey | JCBVEVKMVDYNPQ-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 616.747°C at 760 mmHg (Cal.) |
| Flash point | 326.797°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Angustidine |