|
CAS#: 40226-25-3 Product: N-[(2-Chloro-1-Naphthalenyl)Methylene]-2-Methoxybenzenamine No suppilers available for the product. |
| Name | N-[(2-Chloro-1-Naphthalenyl)Methylene]-2-Methoxybenzenamine |
|---|---|
| Synonyms | 1-(2-Chloro-1-Naphthyl)-N-(2-Methoxyphenyl)Methanimine; (2-Chloro-1-Naphthyl)Methylene-(2-Methoxyphenyl)Amine; Brn 2746127 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14ClNO |
| Molecular Weight | 295.77 |
| CAS Registry Number | 40226-25-3 |
| SMILES | C1=C(C(=CC=C1)N=CC2=C3C(=CC=C2Cl)C=CC=C3)OC |
| InChI | 1S/C18H14ClNO/c1-21-18-9-5-4-8-17(18)20-12-15-14-7-3-2-6-13(14)10-11-16(15)19/h2-12H,1H3 |
| InChIKey | STZTWWYDSITCOB-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.913°C at 760 mmHg (Cal.) |
| Flash point | 253.114°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Chloro-1-Naphthalenyl)Methylene]-2-Methoxybenzenamine |